C24H22Cl6NO3+ — CID 2317161
tris[2-(2,4-dichlorophenoxy)ethyl]azanium (PubChem CID 2317161) has the molecular formula C24H22Cl6NO3+ and a molecular weight of 585.16 g/mol. Its IUPAC name is tris[2-(2,4-dichlorophenoxy)ethyl]azanium.
| Compound Name | tris[2-(2,4-dichlorophenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 2317161 |
| Molecular Formula | C24H22Cl6NO3+ |
| Molecular Weight | 585.16 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | tris[2-(2,4-dichlorophenoxy)ethyl]azanium |
| SMILES | Clc1ccc(OCC[NH+](CCOc2ccc(Cl)cc2Cl)CCOc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21Cl6NO3/c25-16-1-4-22(19(28)13-16)32-10-7-31(8-11-33-23-5-2-17(26)14-20(23)29)9-12-34-24-6-3-18(27)15-21(24)30/h1-6,13-15H,7-12H2/p+1 |
| InChIKey | DQTLUQKGKCCDRY-UHFFFAOYSA-O |
| XLogP | 7.03 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.16 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |