C12H16Cl2NO+ — CID 7446277
1-[2-(2,4-dichlorophenoxy)ethyl]pyrrolidin-1-ium (PubChem CID 7446277) has the molecular formula C12H16Cl2NO+ and a molecular weight of 261.17 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]pyrrolidin-1-ium.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 7446277 |
| Molecular Formula | C12H16Cl2NO+ |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]pyrrolidin-1-ium |
| SMILES | Clc1ccc(OCC[NH+]2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-10-3-4-12(11(14)9-10)16-8-7-15-5-1-2-6-15/h3-4,9H,1-2,5-8H2/p+1 |
| InChIKey | YFMOKECXKNYEFE-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |