C16H20ClNO3 — CID 42250793
(Z)-3-[5-chloro-2-(2-piperidin-1-ium-1-ylethoxy)phenyl]prop-2-enoate (PubChem CID 42250793) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-(2-piperidin-1-ium-1-ylethoxy)phenyl]prop-2-enoate.
| Compound Name | (Z)-3-[5-chloro-2-(2-piperidin-1-ium-1-ylethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42250793 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (Z)-3-[5-chloro-2-(2-piperidin-1-ium-1-ylethoxy)phenyl]prop-2-enoate |
| SMILES | O=C([O-])/C=C\c1cc(Cl)ccc1OCC[NH+]1CCCCC1 |
| InChI | InChI=1S/C16H20ClNO3/c17-14-5-6-15(13(12-14)4-7-16(19)20)21-11-10-18-8-2-1-3-9-18/h4-7,12H,1-3,8-11H2,(H,19,20)/b7-4- |
| InChIKey | ADSSICLDNKFTQM-DAXSKMNVSA-N |
| XLogP | 0.55 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|