C17H26Cl2NO+ — CID 2247168
1-[6-(2,4-dichlorophenoxy)hexyl]piperidin-1-ium (PubChem CID 2247168) has the molecular formula C17H26Cl2NO+ and a molecular weight of 331.31 g/mol. Its IUPAC name is 1-[6-(2,4-dichlorophenoxy)hexyl]piperidin-1-ium.
| Compound Name | 1-[6-(2,4-dichlorophenoxy)hexyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2247168 |
| Molecular Formula | C17H26Cl2NO+ |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[6-(2,4-dichlorophenoxy)hexyl]piperidin-1-ium |
| SMILES | Clc1ccc(OCCCCCC[NH+]2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H25Cl2NO/c18-15-8-9-17(16(19)14-15)21-13-7-2-1-4-10-20-11-5-3-6-12-20/h8-9,14H,1-7,10-13H2/p+1 |
| InChIKey | ZAHSEWFFPXLNBG-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|