C16H25ClNO+ — CID 7381474
1-[2-(2-tert-butyl-4-chlorophenoxy)ethyl]pyrrolidin-1-ium (PubChem CID 7381474) has the molecular formula C16H25ClNO+ and a molecular weight of 282.83 g/mol. Its IUPAC name is 1-[2-(2-tert-butyl-4-chlorophenoxy)ethyl]pyrrolidin-1-ium.
| Compound Name | 1-[2-(2-tert-butyl-4-chlorophenoxy)ethyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 7381474 |
| Molecular Formula | C16H25ClNO+ |
| Molecular Weight | 282.83 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[2-(2-tert-butyl-4-chlorophenoxy)ethyl]pyrrolidin-1-ium |
| SMILES | CC(C)(C)c1cc(Cl)ccc1OCC[NH+]1CCCC1 |
| InChI | InChI=1S/C16H24ClNO/c1-16(2,3)14-12-13(17)6-7-15(14)19-11-10-18-8-4-5-9-18/h6-7,12H,4-5,8-11H2,1-3H3/p+1 |
| InChIKey | KOLGWAUNTZLPDV-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |