C20H33ClNO2+ — CID 2181334
(2S,6S)-4-[4-(2-tert-butyl-4-chlorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2181334) has the molecular formula C20H33ClNO2+ and a molecular weight of 354.94 g/mol. Its IUPAC name is (2S,6S)-4-[4-(2-tert-butyl-4-chlorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2S,6S)-4-[4-(2-tert-butyl-4-chlorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2181334 |
| Molecular Formula | C20H33ClNO2+ |
| Molecular Weight | 354.94 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2S,6S)-4-[4-(2-tert-butyl-4-chlorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | C[C@H]1C[NH+](CCCCOc2ccc(Cl)cc2C(C)(C)C)C[C@H](C)O1 |
| InChI | InChI=1S/C20H32ClNO2/c1-15-13-22(14-16(2)24-15)10-6-7-11-23-19-9-8-17(21)12-18(19)20(3,4)5/h8-9,12,15-16H,6-7,10-11,13-14H2,1-5H3/p+1/t15-,16-/m0/s1 |
| InChIKey | HVDDKMIHPYAPGZ-HOTGVXAUSA-O |
| XLogP | 3.49 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.94 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|