C21H36NO3+ — CID 2183741
(2R,6R)-4-[2-[2-(2-tert-butyl-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2183741) has the molecular formula C21H36NO3+ and a molecular weight of 350.52 g/mol. Its IUPAC name is (2R,6R)-4-[2-[2-(2-tert-butyl-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2R,6R)-4-[2-[2-(2-tert-butyl-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2183741 |
| Molecular Formula | C21H36NO3+ |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R,6R)-4-[2-[2-(2-tert-butyl-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | Cc1ccc(OCCOCC[NH+]2C[C@@H](C)O[C@H](C)C2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H35NO3/c1-16-7-8-20(19(13-16)21(4,5)6)24-12-11-23-10-9-22-14-17(2)25-18(3)15-22/h7-8,13,17-18H,9-12,14-15H2,1-6H3/p+1/t17-,18-/m1/s1 |
| InChIKey | KPEJMMOWDXLDCV-QZTJIDSGSA-O |
| XLogP | 2.38 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|