C18H30NO4+ — CID 2182873
(2R,6S)-4-[2-[2-(2-methoxy-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2182873) has the molecular formula C18H30NO4+ and a molecular weight of 324.44 g/mol. Its IUPAC name is (2R,6S)-4-[2-[2-(2-methoxy-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2R,6S)-4-[2-[2-(2-methoxy-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2182873 |
| Molecular Formula | C18H30NO4+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (2R,6S)-4-[2-[2-(2-methoxy-4-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | COc1cc(C)ccc1OCCOCC[NH+]1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C18H29NO4/c1-14-5-6-17(18(11-14)20-4)22-10-9-21-8-7-19-12-15(2)23-16(3)13-19/h5-6,11,15-16H,7-10,12-13H2,1-4H3/p+1/t15-,16+ |
| InChIKey | SZLCESFNAYSBOH-IYBDPMFKSA-O |
| XLogP | 1.09 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|