C19H30NO4+ — CID 7380370
1-[4-[4-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]butoxy]-3-methoxyphenyl]ethanone (PubChem CID 7380370) has the molecular formula C19H30NO4+ and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-[4-[4-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]butoxy]-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-[4-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]butoxy]-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 7380370 |
| Molecular Formula | C19H30NO4+ |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[4-[4-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]butoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC[NH+]1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H29NO4/c1-14-12-20(13-15(2)24-14)9-5-6-10-23-18-8-7-17(16(3)21)11-19(18)22-4/h7-8,11,14-15H,5-6,9-10,12-13H2,1-4H3/p+1/t14-,15+ |
| InChIKey | HVDNOTGXSYFVOM-GASCZTMLSA-O |
| XLogP | 1.75 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|