C17H26NO3+ — CID 7380245
1-[2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]phenyl]ethanone (PubChem CID 7380245) has the molecular formula C17H26NO3+ and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-[2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]phenyl]ethanone.
| Compound Name | 1-[2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 7380245 |
| Molecular Formula | C17H26NO3+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCC[NH+]1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C17H25NO3/c1-13-11-18(12-14(2)21-13)9-6-10-20-17-8-5-4-7-16(17)15(3)19/h4-5,7-8,13-14H,6,9-12H2,1-3H3/p+1/t13-,14+ |
| InChIKey | YRNSWJKBRZCTGV-OKILXGFUSA-O |
| XLogP | 1.35 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|