C22H30NO2+ — CID 7413622
(2R,6S)-2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholin-4-ium (PubChem CID 7413622) has the molecular formula C22H30NO2+ and a molecular weight of 340.49 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholin-4-ium.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7413622 |
| Molecular Formula | C22H30NO2+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCCCOc2ccccc2-c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H29NO2/c1-18-16-23(17-19(2)25-18)14-8-9-15-24-22-13-7-6-12-21(22)20-10-4-3-5-11-20/h3-7,10-13,18-19H,8-9,14-17H2,1-2H3/p+1/t18-,19+ |
| InChIKey | KJVYOTNIJSFCAY-KDURUIRLSA-O |
| XLogP | 3.20 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|