C16H25FNO2+ — CID 2184520
(2R,6S)-4-[4-(4-fluorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2184520) has the molecular formula C16H25FNO2+ and a molecular weight of 282.38 g/mol. Its IUPAC name is (2R,6S)-4-[4-(4-fluorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2R,6S)-4-[4-(4-fluorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2184520 |
| Molecular Formula | C16H25FNO2+ |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (2R,6S)-4-[4-(4-fluorophenoxy)butyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCCCOc2ccc(F)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H24FNO2/c1-13-11-18(12-14(2)20-13)9-3-4-10-19-16-7-5-15(17)6-8-16/h5-8,13-14H,3-4,9-12H2,1-2H3/p+1/t13-,14+ |
| InChIKey | GQHHYJDZVGBDKK-OKILXGFUSA-O |
| XLogP | 1.68 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|