C25H36NO2+ — CID 7410765
(2R,6R)-2,6-dimethyl-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]butyl]morpholin-4-ium (PubChem CID 7410765) has the molecular formula C25H36NO2+ and a molecular weight of 382.57 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]butyl]morpholin-4-ium.
| Compound Name | (2R,6R)-2,6-dimethyl-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]butyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7410765 |
| Molecular Formula | C25H36NO2+ |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[4-[4-(2-phenylpropan-2-yl)phenoxy]butyl]morpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCCCOc2ccc(C(C)(C)c3ccccc3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H35NO2/c1-20-18-26(19-21(2)28-20)16-8-9-17-27-24-14-12-23(13-15-24)25(3,4)22-10-6-5-7-11-22/h5-7,10-15,20-21H,8-9,16-19H2,1-4H3/p+1/t20-,21-/m1/s1 |
| InChIKey | CCOLCOPPEFRFIM-NHCUHLMSSA-O |
| XLogP | 3.86 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|