C19H30NO2+ — CID 2183046
(2S,6R)-2,6-dimethyl-4-[4-(2-prop-2-enylphenoxy)butyl]morpholin-4-ium (PubChem CID 2183046) has the molecular formula C19H30NO2+ and a molecular weight of 304.45 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-[4-(2-prop-2-enylphenoxy)butyl]morpholin-4-ium.
| Compound Name | (2S,6R)-2,6-dimethyl-4-[4-(2-prop-2-enylphenoxy)butyl]morpholin-4-ium |
|---|---|
| PubChem CID | 2183046 |
| Molecular Formula | C19H30NO2+ |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-[4-(2-prop-2-enylphenoxy)butyl]morpholin-4-ium |
| SMILES | C=CCc1ccccc1OCCCC[NH+]1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H29NO2/c1-4-9-18-10-5-6-11-19(18)21-13-8-7-12-20-14-16(2)22-17(3)15-20/h4-6,10-11,16-17H,1,7-9,12-15H2,2-3H3/p+1/t16-,17+ |
| InChIKey | HAXWKPMSXNFRIR-CALCHBBNSA-O |
| XLogP | 2.27 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|