C20H26NO2+ — CID 7411249
(2S,6S)-2,6-dimethyl-4-[2-(2-phenylphenoxy)ethyl]morpholin-4-ium (PubChem CID 7411249) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-[2-(2-phenylphenoxy)ethyl]morpholin-4-ium.
| Compound Name | (2S,6S)-2,6-dimethyl-4-[2-(2-phenylphenoxy)ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7411249 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-[2-(2-phenylphenoxy)ethyl]morpholin-4-ium |
| SMILES | C[C@H]1C[NH+](CCOc2ccccc2-c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H25NO2/c1-16-14-21(15-17(2)23-16)12-13-22-20-11-7-6-10-19(20)18-8-4-3-5-9-18/h3-11,16-17H,12-15H2,1-2H3/p+1/t16-,17-/m0/s1 |
| InChIKey | NHWONOABSYXUBC-IRXDYDNUSA-O |
| XLogP | 2.42 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |