C18H24N2O+2 — CID 7442998
1-[2-(2-phenylphenoxy)ethyl]piperazine-1,4-diium (PubChem CID 7442998) has the molecular formula C18H24N2O+2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[2-(2-phenylphenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-[2-(2-phenylphenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7442998 |
| Molecular Formula | C18H24N2O+2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-[2-(2-phenylphenoxy)ethyl]piperazine-1,4-diium |
| SMILES | c1ccc(-c2ccccc2OCC[NH+]2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-2-6-16(7-3-1)17-8-4-5-9-18(17)21-15-14-20-12-10-19-11-13-20/h1-9,19H,10-15H2/p+2 |
| InChIKey | NWZRIYUTUFNGHT-UHFFFAOYSA-P |
| XLogP | 0.19 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |