C14H24N2O+2 — CID 7439746
1-[2-(2,5-dimethylphenoxy)ethyl]piperazine-1,4-diium (PubChem CID 7439746) has the molecular formula C14H24N2O+2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-[2-(2,5-dimethylphenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7439746 |
| Molecular Formula | C14H24N2O+2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-[2-(2,5-dimethylphenoxy)ethyl]piperazine-1,4-diium |
| SMILES | Cc1ccc(C)c(OCC[NH+]2CC[NH2+]CC2)c1 |
| InChI | InChI=1S/C14H22N2O/c1-12-3-4-13(2)14(11-12)17-10-9-16-7-5-15-6-8-16/h3-4,11,15H,5-10H2,1-2H3/p+2 |
| InChIKey | KQKAYMBUZTZGOA-UHFFFAOYSA-P |
| XLogP | -0.86 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |