C13H19ClO — CID 43168528
2-(5-chloropentoxy)-1,4-dimethylbenzene (PubChem CID 43168528) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 2-(5-chloropentoxy)-1,4-dimethylbenzene.
| Compound Name | 2-(5-chloropentoxy)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 43168528 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(5-chloropentoxy)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(OCCCCCCl)c1 |
| InChI | InChI=1S/C13H19ClO/c1-11-6-7-12(2)13(10-11)15-9-5-3-4-8-14/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | LQAQNJALQGGEFA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|