C16H28NO+ — CID 2245590
4-(2,5-dimethylphenoxy)butyl-diethylazanium (PubChem CID 2245590) has the molecular formula C16H28NO+ and a molecular weight of 250.41 g/mol. Its IUPAC name is 4-(2,5-dimethylphenoxy)butyl-diethylazanium.
| Compound Name | 4-(2,5-dimethylphenoxy)butyl-diethylazanium |
|---|---|
| PubChem CID | 2245590 |
| Molecular Formula | C16H28NO+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 4-(2,5-dimethylphenoxy)butyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C16H27NO/c1-5-17(6-2)11-7-8-12-18-16-13-14(3)9-10-15(16)4/h9-10,13H,5-8,11-12H2,1-4H3/p+1 |
| InChIKey | ZRDXONHOWRNZKU-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|