C18H31NO3 — CID 118501595
2-[6-(2,5-dimethylphenoxy)hexyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 118501595) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[6-(2,5-dimethylphenoxy)hexyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[6-(2,5-dimethylphenoxy)hexyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 118501595 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 2-[6-(2,5-dimethylphenoxy)hexyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | Cc1ccc(C)c(OCCCCCCN(CCO)CCO)c1 |
| InChI | InChI=1S/C18H31NO3/c1-16-7-8-17(2)18(15-16)22-14-6-4-3-5-9-19(10-12-20)11-13-21/h7-8,15,20-21H,3-6,9-14H2,1-2H3 |
| InChIKey | CDDLRPRUAMIVRN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|