C12H20NO2+ — CID 2262147
2-(2,5-dimethylphenoxy)ethyl-(2-hydroxyethyl)azanium (PubChem CID 2262147) has the molecular formula C12H20NO2+ and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)ethyl-(2-hydroxyethyl)azanium.
| Compound Name | 2-(2,5-dimethylphenoxy)ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2262147 |
| Molecular Formula | C12H20NO2+ |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)ethyl-(2-hydroxyethyl)azanium |
| SMILES | Cc1ccc(C)c(OCC[NH2+]CCO)c1 |
| InChI | InChI=1S/C12H19NO2/c1-10-3-4-11(2)12(9-10)15-8-6-13-5-7-14/h3-4,9,13-14H,5-8H2,1-2H3/p+1 |
| InChIKey | AQRGVCWYSFSTEM-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|