C11H18O2 — CID 143103425
(2,5-dimethylphenoxy)methanol;ethane (PubChem CID 143103425) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2,5-dimethylphenoxy)methanol;ethane.
| Compound Name | (2,5-dimethylphenoxy)methanol;ethane |
|---|---|
| PubChem CID | 143103425 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2,5-dimethylphenoxy)methanol;ethane |
| SMILES | CC.Cc1ccc(C)c(OCO)c1 |
| InChI | InChI=1S/C9H12O2.C2H6/c1-7-3-4-8(2)9(5-7)11-6-10;1-2/h3-5,10H,6H2,1-2H3;1-2H3 |
| InChIKey | KRZKDXXWZBCRLV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|