C14H24NO2+ — CID 6940353
[(2S)-3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-trimethylazanium (PubChem CID 6940353) has the molecular formula C14H24NO2+ and a molecular weight of 238.35 g/mol. Its IUPAC name is [(2S)-3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [(2S)-3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 6940353 |
| Molecular Formula | C14H24NO2+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | [(2S)-3-(2,5-dimethylphenoxy)-2-hydroxypropyl]-trimethylazanium |
| SMILES | Cc1ccc(C)c(OC[C@@H](O)C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C14H24NO2/c1-11-6-7-12(2)14(8-11)17-10-13(16)9-15(3,4)5/h6-8,13,16H,9-10H2,1-5H3/q+1/t13-/m0/s1 |
| InChIKey | PTQZBEFVEPWNKJ-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|