C13H20N2O4 — CID 112673832
2-[[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]amino]oxyacetamide (PubChem CID 112673832) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]amino]oxyacetamide.
| Compound Name | 2-[[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]amino]oxyacetamide |
|---|---|
| PubChem CID | 112673832 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]amino]oxyacetamide |
| SMILES | Cc1ccc(C)c(OCC(O)CNOCC(N)=O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-9-3-4-10(2)12(5-9)18-7-11(16)6-15-19-8-13(14)17/h3-5,11,15-16H,6-8H2,1-2H3,(H2,14,17) |
| InChIKey | LCUAVTBQSHKSDG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|