C15H24O3 — CID 11779994
2-(3,3-diethoxypropoxy)-1,4-dimethylbenzene (PubChem CID 11779994) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(3,3-diethoxypropoxy)-1,4-dimethylbenzene.
| Compound Name | 2-(3,3-diethoxypropoxy)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 11779994 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-(3,3-diethoxypropoxy)-1,4-dimethylbenzene |
| SMILES | CCOC(CCOc1cc(C)ccc1C)OCC |
| InChI | InChI=1S/C15H24O3/c1-5-16-15(17-6-2)9-10-18-14-11-12(3)7-8-13(14)4/h7-8,11,15H,5-6,9-10H2,1-4H3 |
| InChIKey | UMNJBKPHBJFGBR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|