C17H26O3 — CID 101154521
ethyl (2R)-5-(2,5-dimethylphenoxy)-2-ethylpentanoate (PubChem CID 101154521) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl (2R)-5-(2,5-dimethylphenoxy)-2-ethylpentanoate.
| Compound Name | ethyl (2R)-5-(2,5-dimethylphenoxy)-2-ethylpentanoate |
|---|---|
| PubChem CID | 101154521 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl (2R)-5-(2,5-dimethylphenoxy)-2-ethylpentanoate |
| SMILES | CCOC(=O)[C@H](CC)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C17H26O3/c1-5-15(17(18)19-6-2)8-7-11-20-16-12-13(3)9-10-14(16)4/h9-10,12,15H,5-8,11H2,1-4H3/t15-/m1/s1 |
| InChIKey | HKNMFFPQCNTGSN-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|