C18H29NO5 — CID 2935414
N-butan-2-yl-4-(2,5-dimethylphenoxy)butan-1-amine;oxalic acid (PubChem CID 2935414) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is N-butan-2-yl-4-(2,5-dimethylphenoxy)butan-1-amine;oxalic acid.
| Compound Name | N-butan-2-yl-4-(2,5-dimethylphenoxy)butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2935414 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-butan-2-yl-4-(2,5-dimethylphenoxy)butan-1-amine;oxalic acid |
| SMILES | CCC(C)NCCCCOc1cc(C)ccc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H27NO.C2H2O4/c1-5-15(4)17-10-6-7-11-18-16-12-13(2)8-9-14(16)3;3-1(4)2(5)6/h8-9,12,15,17H,5-7,10-11H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | SCUNCKDSQUGMFS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|