C15H21Cl2NO5 — CID 2934611
N-[3-(2,5-dichlorophenoxy)propyl]butan-2-amine;oxalic acid (PubChem CID 2934611) has the molecular formula C15H21Cl2NO5 and a molecular weight of 366.24 g/mol. Its IUPAC name is N-[3-(2,5-dichlorophenoxy)propyl]butan-2-amine;oxalic acid.
| Compound Name | N-[3-(2,5-dichlorophenoxy)propyl]butan-2-amine;oxalic acid |
|---|---|
| PubChem CID | 2934611 |
| Molecular Formula | C15H21Cl2NO5 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[3-(2,5-dichlorophenoxy)propyl]butan-2-amine;oxalic acid |
| SMILES | CCC(C)NCCCOc1cc(Cl)ccc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19Cl2NO.C2H2O4/c1-3-10(2)16-7-4-8-17-13-9-11(14)5-6-12(13)15;3-1(4)2(5)6/h5-6,9-10,16H,3-4,7-8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YPAZHWONPJWLGE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|