C14H21Cl2NO2 — CID 2935622
N-[2-[2-(2,5-dichlorophenoxy)ethoxy]ethyl]butan-2-amine (PubChem CID 2935622) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is N-[2-[2-(2,5-dichlorophenoxy)ethoxy]ethyl]butan-2-amine.
| Compound Name | N-[2-[2-(2,5-dichlorophenoxy)ethoxy]ethyl]butan-2-amine |
|---|---|
| PubChem CID | 2935622 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[2-[2-(2,5-dichlorophenoxy)ethoxy]ethyl]butan-2-amine |
| SMILES | CCC(C)NCCOCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H21Cl2NO2/c1-3-11(2)17-6-7-18-8-9-19-14-10-12(15)4-5-13(14)16/h4-5,10-11,17H,3,6-9H2,1-2H3 |
| InChIKey | FTQSZCYIXZUKBK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|