C16H27NO4 — CID 2934297
N-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]butan-2-amine (PubChem CID 2934297) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]butan-2-amine.
| Compound Name | N-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]butan-2-amine |
|---|---|
| PubChem CID | 2934297 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-[2-[2-(2,6-dimethoxyphenoxy)ethoxy]ethyl]butan-2-amine |
| SMILES | CCC(C)NCCOCCOc1c(OC)cccc1OC |
| InChI | InChI=1S/C16H27NO4/c1-5-13(2)17-9-10-20-11-12-21-16-14(18-3)7-6-8-15(16)19-4/h6-8,13,17H,5,9-12H2,1-4H3 |
| InChIKey | CRQMEHYYEVMXOR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|