C18H29NO3 — CID 2181758
(2S)-N-[2-[2-(4-methoxy-2-prop-2-enylphenoxy)ethoxy]ethyl]butan-2-amine (PubChem CID 2181758) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2S)-N-[2-[2-(4-methoxy-2-prop-2-enylphenoxy)ethoxy]ethyl]butan-2-amine.
| Compound Name | (2S)-N-[2-[2-(4-methoxy-2-prop-2-enylphenoxy)ethoxy]ethyl]butan-2-amine |
|---|---|
| PubChem CID | 2181758 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2S)-N-[2-[2-(4-methoxy-2-prop-2-enylphenoxy)ethoxy]ethyl]butan-2-amine |
| SMILES | C=CCc1cc(OC)ccc1OCCOCCN[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO3/c1-5-7-16-14-17(20-4)8-9-18(16)22-13-12-21-11-10-19-15(3)6-2/h5,8-9,14-15,19H,1,6-7,10-13H2,2-4H3/t15-/m0/s1 |
| InChIKey | CKPMLXUKTSZWTF-HNNXBMFYSA-N |
| XLogP | 3.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|