C17H22ClNO — CID 2181440
(2R)-N-[3-(4-chloronaphthalen-1-yl)oxypropyl]butan-2-amine (PubChem CID 2181440) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (2R)-N-[3-(4-chloronaphthalen-1-yl)oxypropyl]butan-2-amine.
| Compound Name | (2R)-N-[3-(4-chloronaphthalen-1-yl)oxypropyl]butan-2-amine |
|---|---|
| PubChem CID | 2181440 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2R)-N-[3-(4-chloronaphthalen-1-yl)oxypropyl]butan-2-amine |
| SMILES | CC[C@@H](C)NCCCOc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H22ClNO/c1-3-13(2)19-11-6-12-20-17-10-9-16(18)14-7-4-5-8-15(14)17/h4-5,7-10,13,19H,3,6,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | GTYQXQKHVHELLY-CYBMUJFWSA-N |
| XLogP | 4.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|