C15H23NO6 — CID 2865464
N-[2-(2,5-dimethylphenoxy)ethyl]-2-methoxyethanamine;oxalic acid (PubChem CID 2865464) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenoxy)ethyl]-2-methoxyethanamine;oxalic acid.
| Compound Name | N-[2-(2,5-dimethylphenoxy)ethyl]-2-methoxyethanamine;oxalic acid |
|---|---|
| PubChem CID | 2865464 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[2-(2,5-dimethylphenoxy)ethyl]-2-methoxyethanamine;oxalic acid |
| SMILES | COCCNCCOc1cc(C)ccc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H21NO2.C2H2O4/c1-11-4-5-12(2)13(10-11)16-9-7-14-6-8-15-3;3-1(4)2(5)6/h4-5,10,14H,6-9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XEVMRSDTVUQKTH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|