C21H35NO7 — CID 2923884
N-[2-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid (PubChem CID 2923884) has the molecular formula C21H35NO7 and a molecular weight of 413.51 g/mol. Its IUPAC name is N-[2-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid.
| Compound Name | N-[2-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2923884 |
| Molecular Formula | C21H35NO7 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[2-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid |
| SMILES | COCCCNCCOCCOc1cc(C)ccc1C(C)(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H33NO3.C2H2O4/c1-16-7-8-17(19(2,3)4)18(15-16)23-14-13-22-12-10-20-9-6-11-21-5;3-1(4)2(5)6/h7-8,15,20H,6,9-14H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | SQNPEDMTRRBMTA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|