C17H25Cl2NO7 — CID 2869711
N-[2-[2-(2,4-dichloro-6-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid (PubChem CID 2869711) has the molecular formula C17H25Cl2NO7 and a molecular weight of 426.29 g/mol. Its IUPAC name is N-[2-[2-(2,4-dichloro-6-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid.
| Compound Name | N-[2-[2-(2,4-dichloro-6-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2869711 |
| Molecular Formula | C17H25Cl2NO7 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-[2-(2,4-dichloro-6-methylphenoxy)ethoxy]ethyl]-3-methoxypropan-1-amine;oxalic acid |
| SMILES | COCCCNCCOCCOc1c(C)cc(Cl)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H23Cl2NO3.C2H2O4/c1-12-10-13(16)11-14(17)15(12)21-9-8-20-7-5-18-4-3-6-19-2;3-1(4)2(5)6/h10-11,18H,3-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YKOWICISEUPYDC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|