C15H21Cl2NO7 — CID 2923315
N-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-2-methoxyethanamine;oxalic acid (PubChem CID 2923315) has the molecular formula C15H21Cl2NO7 and a molecular weight of 398.24 g/mol. Its IUPAC name is N-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-2-methoxyethanamine;oxalic acid.
| Compound Name | N-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-2-methoxyethanamine;oxalic acid |
|---|---|
| PubChem CID | 2923315 |
| Molecular Formula | C15H21Cl2NO7 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-2-methoxyethanamine;oxalic acid |
| SMILES | COCCNCCOCCOc1ccc(Cl)c(Cl)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19Cl2NO3.C2H2O4/c1-17-6-4-16-5-7-18-8-9-19-11-2-3-12(14)13(15)10-11;3-1(4)2(5)6/h2-3,10,16H,4-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YIEGWXFVGBGDNH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|