C14H20BrNO7 — CID 2869727
2-[2-[2-(4-bromophenoxy)ethoxy]ethylamino]ethanol;oxalic acid (PubChem CID 2869727) has the molecular formula C14H20BrNO7 and a molecular weight of 394.22 g/mol. Its IUPAC name is 2-[2-[2-(4-bromophenoxy)ethoxy]ethylamino]ethanol;oxalic acid.
| Compound Name | 2-[2-[2-(4-bromophenoxy)ethoxy]ethylamino]ethanol;oxalic acid |
|---|---|
| PubChem CID | 2869727 |
| Molecular Formula | C14H20BrNO7 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[2-[2-(4-bromophenoxy)ethoxy]ethylamino]ethanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OCCNCCOCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H18BrNO3.C2H2O4/c13-11-1-3-12(4-2-11)17-10-9-16-8-6-14-5-7-15;3-1(4)2(5)6/h1-4,14-15H,5-10H2;(H,3,4)(H,5,6) |
| InChIKey | QVTADWGDSKSGSI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|