C13H18BrNO6 — CID 2922414
2-[3-(3-bromophenoxy)propylamino]ethanol;oxalic acid (PubChem CID 2922414) has the molecular formula C13H18BrNO6 and a molecular weight of 364.19 g/mol. Its IUPAC name is 2-[3-(3-bromophenoxy)propylamino]ethanol;oxalic acid.
| Compound Name | 2-[3-(3-bromophenoxy)propylamino]ethanol;oxalic acid |
|---|---|
| PubChem CID | 2922414 |
| Molecular Formula | C13H18BrNO6 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-[3-(3-bromophenoxy)propylamino]ethanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OCCNCCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO2.C2H2O4/c12-10-3-1-4-11(9-10)15-8-2-5-13-6-7-14;3-1(4)2(5)6/h1,3-4,9,13-14H,2,5-8H2;(H,3,4)(H,5,6) |
| InChIKey | JXLGWDLHXCVJOU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|