C12H17BrN2O5 — CID 2923572
N'-[2-(3-bromophenoxy)ethyl]ethane-1,2-diamine;oxalic acid (PubChem CID 2923572) has the molecular formula C12H17BrN2O5 and a molecular weight of 349.18 g/mol. Its IUPAC name is N'-[2-(3-bromophenoxy)ethyl]ethane-1,2-diamine;oxalic acid.
| Compound Name | N'-[2-(3-bromophenoxy)ethyl]ethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 2923572 |
| Molecular Formula | C12H17BrN2O5 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | N'-[2-(3-bromophenoxy)ethyl]ethane-1,2-diamine;oxalic acid |
| SMILES | NCCNCCOc1cccc(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H15BrN2O.C2H2O4/c11-9-2-1-3-10(8-9)14-7-6-13-5-4-12;3-1(4)2(5)6/h1-3,8,13H,4-7,12H2;(H,3,4)(H,5,6) |
| InChIKey | KMYPVFCNHGGUCE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|