C14H20BrNO5 — CID 2924091
N-[2-(3-bromophenoxy)ethyl]butan-1-amine;oxalic acid (PubChem CID 2924091) has the molecular formula C14H20BrNO5 and a molecular weight of 362.22 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]butan-1-amine;oxalic acid.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2924091 |
| Molecular Formula | C14H20BrNO5 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]butan-1-amine;oxalic acid |
| SMILES | CCCCNCCOc1cccc(Br)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H18BrNO.C2H2O4/c1-2-3-7-14-8-9-15-12-6-4-5-11(13)10-12;3-1(4)2(5)6/h4-6,10,14H,2-3,7-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ORYNOHNDINUGCK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|