C12H16BrNO2 — CID 113099626
N-[2-(3-bromophenoxy)ethyl]butanamide (PubChem CID 113099626) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]butanamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 113099626 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]butanamide |
| SMILES | CCCC(=O)NCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrNO2/c1-2-4-12(15)14-7-8-16-11-6-3-5-10(13)9-11/h3,5-6,9H,2,4,7-8H2,1H3,(H,14,15) |
| InChIKey | WNZUHPJMMGREST-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|