C11H18N2O2 — CID 82339456
N'-[2-(3-methoxyphenoxy)ethyl]ethane-1,2-diamine (PubChem CID 82339456) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N'-[2-(3-methoxyphenoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(3-methoxyphenoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 82339456 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N'-[2-(3-methoxyphenoxy)ethyl]ethane-1,2-diamine |
| SMILES | COc1cccc(OCCNCCN)c1 |
| InChI | InChI=1S/C11H18N2O2/c1-14-10-3-2-4-11(9-10)15-8-7-13-6-5-12/h2-4,9,13H,5-8,12H2,1H3 |
| InChIKey | IZQIJYHHFYBBBC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|