C15H26N2O2 — CID 83960627
N'-[2-(4-methoxyphenoxy)ethyl]hexane-1,6-diamine (PubChem CID 83960627) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenoxy)ethyl]hexane-1,6-diamine.
| Compound Name | N'-[2-(4-methoxyphenoxy)ethyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 83960627 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N'-[2-(4-methoxyphenoxy)ethyl]hexane-1,6-diamine |
| SMILES | COc1ccc(OCCNCCCCCCN)cc1 |
| InChI | InChI=1S/C15H26N2O2/c1-18-14-6-8-15(9-7-14)19-13-12-17-11-5-3-2-4-10-16/h6-9,17H,2-5,10-13,16H2,1H3 |
| InChIKey | NRRSQGWMRVHDBN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|