C14H24N2O — CID 2299706
N'-[4-(3-ethylphenoxy)butyl]ethane-1,2-diamine (PubChem CID 2299706) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-[4-(3-ethylphenoxy)butyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(3-ethylphenoxy)butyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2299706 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N'-[4-(3-ethylphenoxy)butyl]ethane-1,2-diamine |
| SMILES | CCc1cccc(OCCCCNCCN)c1 |
| InChI | InChI=1S/C14H24N2O/c1-2-13-6-5-7-14(12-13)17-11-4-3-9-16-10-8-15/h5-7,12,16H,2-4,8-11,15H2,1H3 |
| InChIKey | KGUJPFVZTUZVJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|