C25H40N2O — CID 142253201
N'-[(3-ethylphenyl)methyl]propane-1,3-diamine;1-hexoxy-3-methylbenzene (PubChem CID 142253201) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is N'-[(3-ethylphenyl)methyl]propane-1,3-diamine;1-hexoxy-3-methylbenzene.
| Compound Name | N'-[(3-ethylphenyl)methyl]propane-1,3-diamine;1-hexoxy-3-methylbenzene |
|---|---|
| PubChem CID | 142253201 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | N'-[(3-ethylphenyl)methyl]propane-1,3-diamine;1-hexoxy-3-methylbenzene |
| SMILES | CCCCCCOc1cccc(C)c1.CCc1cccc(CNCCCN)c1 |
| InChI | InChI=1S/C13H20O.C12H20N2/c1-3-4-5-6-10-14-13-9-7-8-12(2)11-13;1-2-11-5-3-6-12(9-11)10-14-8-4-7-13/h7-9,11H,3-6,10H2,1-2H3;3,5-6,9,14H,2,4,7-8,10,13H2,1H3 |
| InChIKey | AUTJRMYJKNRFIA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|