C17H27NO6 — CID 2869793
N-[2-[2-(4-methylphenoxy)ethoxy]ethyl]butan-1-amine;oxalic acid (PubChem CID 2869793) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is N-[2-[2-(4-methylphenoxy)ethoxy]ethyl]butan-1-amine;oxalic acid.
| Compound Name | N-[2-[2-(4-methylphenoxy)ethoxy]ethyl]butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2869793 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[2-[2-(4-methylphenoxy)ethoxy]ethyl]butan-1-amine;oxalic acid |
| SMILES | CCCCNCCOCCOc1ccc(C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H25NO2.C2H2O4/c1-3-4-9-16-10-11-17-12-13-18-15-7-5-14(2)6-8-15;3-1(4)2(5)6/h5-8,16H,3-4,9-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IGMVQRDEVKGZAY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|