C19H28Cl2N2O6 — CID 2977574
4-(2,4-dichloro-6-methylphenoxy)-N-(2-morpholin-4-ylethyl)butan-1-amine;oxalic acid (PubChem CID 2977574) has the molecular formula C19H28Cl2N2O6 and a molecular weight of 451.35 g/mol. Its IUPAC name is 4-(2,4-dichloro-6-methylphenoxy)-N-(2-morpholin-4-ylethyl)butan-1-amine;oxalic acid.
| Compound Name | 4-(2,4-dichloro-6-methylphenoxy)-N-(2-morpholin-4-ylethyl)butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2977574 |
| Molecular Formula | C19H28Cl2N2O6 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-(2,4-dichloro-6-methylphenoxy)-N-(2-morpholin-4-ylethyl)butan-1-amine;oxalic acid |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCCCCNCCN1CCOCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H26Cl2N2O2.C2H2O4/c1-14-12-15(18)13-16(19)17(14)23-9-3-2-4-20-5-6-21-7-10-22-11-8-21;3-1(4)2(5)6/h12-13,20H,2-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RGGZHDWCOXTWRU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|