C13H16Cl3NO6 — CID 2865543
oxalic acid;2-[3-(2,4,6-trichlorophenoxy)propylamino]ethanol (PubChem CID 2865543) has the molecular formula C13H16Cl3NO6 and a molecular weight of 388.63 g/mol. Its IUPAC name is oxalic acid;2-[3-(2,4,6-trichlorophenoxy)propylamino]ethanol.
| Compound Name | oxalic acid;2-[3-(2,4,6-trichlorophenoxy)propylamino]ethanol |
|---|---|
| PubChem CID | 2865543 |
| Molecular Formula | C13H16Cl3NO6 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | oxalic acid;2-[3-(2,4,6-trichlorophenoxy)propylamino]ethanol |
| SMILES | O=C(O)C(=O)O.OCCNCCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO2.C2H2O4/c12-8-6-9(13)11(10(14)7-8)17-5-1-2-15-3-4-16;3-1(4)2(5)6/h6-7,15-16H,1-5H2;(H,3,4)(H,5,6) |
| InChIKey | PDICIIJECQVOJU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|