C15H12Cl5NO — CID 67892827
N-[(2,4-dichlorophenyl)methyl]-2-(2,4,6-trichlorophenoxy)ethanamine (PubChem CID 67892827) has the molecular formula C15H12Cl5NO and a molecular weight of 399.53 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-(2,4,6-trichlorophenoxy)ethanamine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-(2,4,6-trichlorophenoxy)ethanamine |
|---|---|
| PubChem CID | 67892827 |
| Molecular Formula | C15H12Cl5NO |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-(2,4,6-trichlorophenoxy)ethanamine |
| SMILES | Clc1ccc(CNCCOc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl5NO/c16-10-2-1-9(12(18)5-10)8-21-3-4-22-15-13(19)6-11(17)7-14(15)20/h1-2,5-7,21H,3-4,8H2 |
| InChIKey | YKKZQRCVSGFLIS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|