C14H18Cl3NO — CID 63505531
N-(cyclopentylmethyl)-2-(2,4,6-trichlorophenoxy)ethanamine (PubChem CID 63505531) has the molecular formula C14H18Cl3NO and a molecular weight of 322.66 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2-(2,4,6-trichlorophenoxy)ethanamine.
| Compound Name | N-(cyclopentylmethyl)-2-(2,4,6-trichlorophenoxy)ethanamine |
|---|---|
| PubChem CID | 63505531 |
| Molecular Formula | C14H18Cl3NO |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-(cyclopentylmethyl)-2-(2,4,6-trichlorophenoxy)ethanamine |
| SMILES | Clc1cc(Cl)c(OCCNCC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl3NO/c15-11-7-12(16)14(13(17)8-11)19-6-5-18-9-10-3-1-2-4-10/h7-8,10,18H,1-6,9H2 |
| InChIKey | LWWWURZMVLXDAZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|